C4BrCl2F7 — CID 139890181
1-bromo-3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutane (PubChem CID 139890181) has the molecular formula C4BrCl2F7 and a molecular weight of 331.84 g/mol. Its IUPAC name is 1-bromo-3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutane.
| Compound Name | 1-bromo-3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutane |
|---|---|
| PubChem CID | 139890181 |
| Molecular Formula | C4BrCl2F7 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 329.84 |
| IUPAC Name | 1-bromo-3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutane |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C4BrCl2F7/c5-3(11,12)2(9,10)1(6,8)4(7,13)14 |
| InChIKey | UTAYBZYXSKEXQU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|