C4Cl3F7O2S — CID 131737844
1,3,4-trichloro-1,2,2,3,4,4-hexafluorobutane-1-sulfonyl fluoride (PubChem CID 131737844) has the molecular formula C4Cl3F7O2S and a molecular weight of 351.45 g/mol. Its IUPAC name is 1,3,4-trichloro-1,2,2,3,4,4-hexafluorobutane-1-sulfonyl fluoride.
| Compound Name | 1,3,4-trichloro-1,2,2,3,4,4-hexafluorobutane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 131737844 |
| Molecular Formula | C4Cl3F7O2S |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 349.86 |
| IUPAC Name | 1,3,4-trichloro-1,2,2,3,4,4-hexafluorobutane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C4Cl3F7O2S/c5-1(8,3(6,11)12)2(9,10)4(7,13)17(14,15)16 |
| InChIKey | ISLWBEQYKZTWJU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|