C4HClF8O3S — CID 87557611
1-chloro-1,2,2,3,3,4,4,4-octafluorobutane-1-sulfonic acid (PubChem CID 87557611) has the molecular formula C4HClF8O3S and a molecular weight of 316.55 g/mol. Its IUPAC name is 1-chloro-1,2,2,3,3,4,4,4-octafluorobutane-1-sulfonic acid.
| Compound Name | 1-chloro-1,2,2,3,3,4,4,4-octafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 87557611 |
| Molecular Formula | C4HClF8O3S |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 315.92 |
| IUPAC Name | 1-chloro-1,2,2,3,3,4,4,4-octafluorobutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HClF8O3S/c5-3(10,17(14,15)16)1(6,7)2(8,9)4(11,12)13/h(H,14,15,16) |
| InChIKey | IQCHUJYEVZZWCI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|