C10HF21O3S — CID 87186932
1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonic acid (PubChem CID 87186932) has the molecular formula C10HF21O3S and a molecular weight of 600.14 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonic acid.
| Compound Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonic acid |
|---|---|
| PubChem CID | 87186932 |
| Molecular Formula | C10HF21O3S |
| Molecular Weight | 600.14 g/mol |
| Exact Mass | 599.93 |
| IUPAC Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10HF21O3S/c11-1(12,3(15,16)5(19,20)7(23,24)9(26,27)28)2(13,14)4(17,18)6(21,22)8(25,10(29,30)31)35(32,33)34/h(H,32,33,34) |
| InChIKey | LMLILMWRPFZXPG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.14 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|