C4Cl2F8O3S — CID 11360103
2-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonyl fluoride (PubChem CID 11360103) has the molecular formula C4Cl2F8O3S and a molecular weight of 351.00 g/mol. Its IUPAC name is 2-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonyl fluoride.
| Compound Name | 2-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonyl fluoride |
|---|---|
| PubChem CID | 11360103 |
| Molecular Formula | C4Cl2F8O3S |
| Molecular Weight | 351.00 g/mol |
| Exact Mass | 349.88 |
| IUPAC Name | 2-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,2-tetrafluoroethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)OC(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C4Cl2F8O3S/c5-1(7,8)2(6,9)17-3(10,11)4(12,13)18(14,15)16 |
| InChIKey | WQZTYCMAGDYRFR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.00 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|