C7HCl2F11O4 — CID 162396472
2-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid (PubChem CID 162396472) has the molecular formula C7HCl2F11O4 and a molecular weight of 428.97 g/mol. Its IUPAC name is 2-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid.
| Compound Name | 2-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 162396472 |
| Molecular Formula | C7HCl2F11O4 |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 427.91 |
| IUPAC Name | 2-[1-(1,2-dichloro-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoropropan-2-yl]oxy-2,2-difluoroacetic acid |
| SMILES | O=C(O)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C7HCl2F11O4/c8-4(13,14)5(9,15)24-7(19,20)3(12,6(16,17)18)23-2(10,11)1(21)22/h(H,21,22) |
| InChIKey | HMKODDSBKGJEOM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|