C4HClF6O3 — CID 15570709
2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-2,2-difluoroacetic acid (PubChem CID 15570709) has the molecular formula C4HClF6O3 and a molecular weight of 246.49 g/mol. Its IUPAC name is 2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-2,2-difluoroacetic acid.
| Compound Name | 2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 15570709 |
| Molecular Formula | C4HClF6O3 |
| Molecular Weight | 246.49 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 2-(2-chloro-1,1,2,2-tetrafluoroethoxy)-2,2-difluoroacetic acid |
| SMILES | O=C(O)C(F)(F)OC(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C4HClF6O3/c5-3(8,9)4(10,11)14-2(6,7)1(12)13/h(H,12,13) |
| InChIKey | GYBJSXMWSWYNST-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|