C4H2F4O6 — CID 141118237
2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid (PubChem CID 141118237) has the molecular formula C4H2F4O6 and a molecular weight of 222.05 g/mol. Its IUPAC name is 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid.
| Compound Name | 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 141118237 |
| Molecular Formula | C4H2F4O6 |
| Molecular Weight | 222.05 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid |
| SMILES | O=C(O)C(F)(F)OOC(F)(F)C(=O)O |
| InChI | InChI=1S/C4H2F4O6/c5-3(6,1(9)10)13-14-4(7,8)2(11)12/h(H,9,10)(H,11,12) |
| InChIKey | FTZPSGFARNBDCF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.05 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|