2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid

C4H2F4O6 — CID 141118237

IUPAC2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)OOC(F)(F)C(=O)O
InChIInChI=1S/C4H2F4O6/c5-3(6,1(9)10)13-14-4(7,8)2(11)12/h(H,9,10)(H,11,12)
InChIKeyFTZPSGFARNBDCF-UHFFFAOYSA-N
MW222.05 g/mol
LogP0.29
Rot. Bonds5

About 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid

2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid (PubChem CID 141118237) has the molecular formula C4H2F4O6 and a molecular weight of 222.05 g/mol. Its IUPAC name is 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid.

Molecular Properties

Compound Name2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid
PubChem CID141118237
Molecular FormulaC4H2F4O6
Molecular Weight222.05 g/mol
Exact Mass221.98
IUPAC Name2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid
SMILESO=C(O)C(F)(F)OOC(F)(F)C(=O)O
InChIInChI=1S/C4H2F4O6/c5-3(6,1(9)10)13-14-4(7,8)2(11)12/h(H,9,10)(H,11,12)
InChIKeyFTZPSGFARNBDCF-UHFFFAOYSA-N
XLogP0.29
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.05
LogP ≤ 50.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid?
The IUPAC name of 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid (CID 141118237) is 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid.
What is the SMILES notation for 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid?
The canonical SMILES for 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid is O=C(O)C(F)(F)OOC(F)(F)C(=O)O.
What is the InChIKey of 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid?
The InChIKey is FTZPSGFARNBDCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F4O6/c5-3(6,1(9)10)13-14-4(7,8)2(11)12/h(H,9,10)(H,11,12).
What are the key properties of 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid?
2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid has a molecular weight of 222.05 g/mol, XLogP of 0.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carboxy(difluoro)methyl]peroxy-2,2-difluoroacetic acid is sourced from PubChem (CID 141118237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).