C5H4F9NO4 — CID 175001633
azane;2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid (PubChem CID 175001633) has the molecular formula C5H4F9NO4 and a molecular weight of 313.07 g/mol. Its IUPAC name is azane;2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid.
| Compound Name | azane;2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 175001633 |
| Molecular Formula | C5H4F9NO4 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | azane;2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid |
| SMILES | N.O=C(O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C5HF9O4.H3N/c6-2(7,1(15)16)17-3(8,9)4(10,11)18-5(12,13)14;/h(H,15,16);1H3 |
| InChIKey | JTTYCHQVWWBCCE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|