C6F10O4 — CID 23235156
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2-trifluoro-2-oxoethoxy)ethoxy]acetyl fluoride (PubChem CID 23235156) has the molecular formula C6F10O4 and a molecular weight of 326.04 g/mol. Its IUPAC name is 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2-trifluoro-2-oxoethoxy)ethoxy]acetyl fluoride.
| Compound Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2-trifluoro-2-oxoethoxy)ethoxy]acetyl fluoride |
|---|---|
| PubChem CID | 23235156 |
| Molecular Formula | C6F10O4 |
| Molecular Weight | 326.04 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2-trifluoro-2-oxoethoxy)ethoxy]acetyl fluoride |
| SMILES | O=C(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(=O)F |
| InChI | InChI=1S/C6F10O4/c7-1(17)3(9,10)19-5(13,14)6(15,16)20-4(11,12)2(8)18 |
| InChIKey | YOESRXYSDZQSHW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.04 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|