C7F11O3- — CID 162679402
2,2-difluoro-2-[(E)-1,1,2,2,3,4,5,5,5-nonafluoropent-3-enoxy]acetate (PubChem CID 162679402) has the molecular formula C7F11O3- and a molecular weight of 341.05 g/mol. Its IUPAC name is 2,2-difluoro-2-[(E)-1,1,2,2,3,4,5,5,5-nonafluoropent-3-enoxy]acetate.
| Compound Name | 2,2-difluoro-2-[(E)-1,1,2,2,3,4,5,5,5-nonafluoropent-3-enoxy]acetate |
|---|---|
| PubChem CID | 162679402 |
| Molecular Formula | C7F11O3- |
| Molecular Weight | 341.05 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2,2-difluoro-2-[(E)-1,1,2,2,3,4,5,5,5-nonafluoropent-3-enoxy]acetate |
| SMILES | O=C([O-])C(F)(F)OC(F)(F)C(F)(F)/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C7HF11O3/c8-1(2(9)5(12,13)14)4(10,11)7(17,18)21-6(15,16)3(19)20/h(H,19,20)/p-1/b2-1+ |
| InChIKey | NAUFVZVWCKCVPL-OWOJBTEDSA-M |
| XLogP | 2.29 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.05 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|