C9ClF16O4- — CID 102400219
2-[2-[2-[chloro(difluoro)methyl]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,2-difluoroacetate (PubChem CID 102400219) has the molecular formula C9ClF16O4- and a molecular weight of 511.52 g/mol. Its IUPAC name is 2-[2-[2-[chloro(difluoro)methyl]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,2-difluoroacetate.
| Compound Name | 2-[2-[2-[chloro(difluoro)methyl]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 102400219 |
| Molecular Formula | C9ClF16O4- |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 510.92 |
| IUPAC Name | 2-[2-[2-[chloro(difluoro)methyl]-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropoxy]-2,2-difluoroacetate |
| SMILES | O=C([O-])C(F)(F)OC(F)(F)C(F)(OC(F)(F)C(F)(C(F)(F)F)C(F)(F)Cl)C(F)(F)F |
| InChI | InChI=1S/C9HClF16O4/c10-5(15,16)3(13,6(17,18)19)8(23,24)30-4(14,7(20,21)22)9(25,26)29-2(11,12)1(27)28/h(H,27,28)/p-1 |
| InChIKey | IHKHVYIZHSTOPG-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|