C9F17NaO5 — CID 175696447
sodium 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetate (PubChem CID 175696447) has the molecular formula C9F17NaO5 and a molecular weight of 534.05 g/mol. Its IUPAC name is sodium 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetate.
| Compound Name | sodium 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 175696447 |
| Molecular Formula | C9F17NaO5 |
| Molecular Weight | 534.05 g/mol |
| Exact Mass | 533.94 |
| IUPAC Name | sodium 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]ethoxy]acetate |
| SMILES | O=C([O-])C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C9HF17O5.Na/c10-2(11,1(27)28)29-6(19,20)7(21,22)31-9(25,26)8(23,24)30-5(17,18)3(12,13)4(14,15)16;/h(H,27,28);/q;+1/p-1 |
| InChIKey | PLZMEKWKKFJCJO-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.05 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|