C5F12O — CID 10968705
1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane (PubChem CID 10968705) has the molecular formula C5F12O and a molecular weight of 304.03 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane |
|---|---|
| PubChem CID | 10968705 |
| Molecular Formula | C5F12O |
| Molecular Weight | 304.03 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propane |
| SMILES | FC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5F12O/c6-1(7,2(8,9)10)4(14,15)18-5(16,17)3(11,12)13 |
| InChIKey | YBVRDNKKIWCSHJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.03 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|