C6F14O — CID 11325674
1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane (PubChem CID 11325674) has the molecular formula C6F14O and a molecular weight of 354.04 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane |
|---|---|
| PubChem CID | 11325674 |
| Molecular Formula | C6F14O |
| Molecular Weight | 354.04 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,2-pentafluoroethoxy)butane |
| SMILES | FC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F14O/c7-1(8,3(11,12)13)2(9,10)5(17,18)21-6(19,20)4(14,15)16 |
| InChIKey | SGMMSEZNRKQFEX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.04 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|