C8F16O3 — CID 174348525
1,1,2,2,2-pentafluoroethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)acetate (PubChem CID 174348525) has the molecular formula C8F16O3 and a molecular weight of 448.05 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)acetate.
| Compound Name | 1,1,2,2,2-pentafluoroethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)acetate |
|---|---|
| PubChem CID | 174348525 |
| Molecular Formula | C8F16O3 |
| Molecular Weight | 448.05 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl 2,2-difluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)acetate |
| SMILES | O=C(OC(F)(F)C(F)(F)F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F16O3/c9-2(10,1(25)26-8(23,24)6(18,19)20)27-7(21,22)4(13,14)3(11,12)5(15,16)17 |
| InChIKey | VRTBSLNTSVWCPT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.05 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|