C12F24O2 — CID 11039479
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl 2,2,2-trifluoroacetate (PubChem CID 11039479) has the molecular formula C12F24O2 and a molecular weight of 632.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl 2,2,2-trifluoroacetate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11039479 |
| Molecular Formula | C12F24O2 |
| Molecular Weight | 632.08 g/mol |
| Exact Mass | 631.95 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F24O2/c13-2(14,15)1(37)38-12(35,36)10(30,31)8(26,27)6(22,23)4(18,19)3(16,17)5(20,21)7(24,25)9(28,29)11(32,33)34 |
| InChIKey | FARLVYSUUQEVCW-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.08 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|