C16H2F26O4 — CID 173040296
bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl) but-2-enedioate (PubChem CID 173040296) has the molecular formula C16H2F26O4 and a molecular weight of 752.14 g/mol. Its IUPAC name is bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl) but-2-enedioate.
| Compound Name | bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl) but-2-enedioate |
|---|---|
| PubChem CID | 173040296 |
| Molecular Formula | C16H2F26O4 |
| Molecular Weight | 752.14 g/mol |
| Exact Mass | 751.95 |
| IUPAC Name | bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl) but-2-enedioate |
| SMILES | O=C(C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H2F26O4/c17-5(18,9(25,26)13(33,34)35)7(21,22)11(29,30)15(39,40)45-3(43)1-2-4(44)46-16(41,42)12(31,32)8(23,24)6(19,20)10(27,28)14(36,37)38/h1-2H |
| InChIKey | BMYLEPSYLSNUAR-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.14 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|