C16H14F14O4 — CID 88503638
bis(3,3,4,4,5,5,5-heptafluoro-2-methylpentan-2-yl) (E)-but-2-enedioate (PubChem CID 88503638) has the molecular formula C16H14F14O4 and a molecular weight of 536.26 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,5-heptafluoro-2-methylpentan-2-yl) (E)-but-2-enedioate.
| Compound Name | bis(3,3,4,4,5,5,5-heptafluoro-2-methylpentan-2-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88503638 |
| Molecular Formula | C16H14F14O4 |
| Molecular Weight | 536.26 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | bis(3,3,4,4,5,5,5-heptafluoro-2-methylpentan-2-yl) (E)-but-2-enedioate |
| SMILES | CC(C)(OC(=O)/C=C/C(=O)OC(C)(C)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F14O4/c1-9(2,11(17,18)13(21,22)15(25,26)27)33-7(31)5-6-8(32)34-10(3,4)12(19,20)14(23,24)16(28,29)30/h5-6H,1-4H3/b6-5+ |
| InChIKey | PJFINPXMXNAYPR-AATRIKPKSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|