C18H20F12O4 — CID 88614543
bis[1,1,1-trifluoro-3,3-dimethyl-2-(trifluoromethyl)butan-2-yl] (E)-but-2-enedioate (PubChem CID 88614543) has the molecular formula C18H20F12O4 and a molecular weight of 528.33 g/mol. Its IUPAC name is bis[1,1,1-trifluoro-3,3-dimethyl-2-(trifluoromethyl)butan-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[1,1,1-trifluoro-3,3-dimethyl-2-(trifluoromethyl)butan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88614543 |
| Molecular Formula | C18H20F12O4 |
| Molecular Weight | 528.33 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | bis[1,1,1-trifluoro-3,3-dimethyl-2-(trifluoromethyl)butan-2-yl] (E)-but-2-enedioate |
| SMILES | CC(C)(C)C(OC(=O)/C=C/C(=O)OC(C(C)(C)C)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H20F12O4/c1-11(2,3)13(15(19,20)21,16(22,23)24)33-9(31)7-8-10(32)34-14(12(4,5)6,17(25,26)27)18(28,29)30/h7-8H,1-6H3/b8-7+ |
| InChIKey | WCCNEZFJIQOXIP-BQYQJAHWSA-N |
| XLogP | 6.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.33 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|