C16H30O2 — CID 139994874
(3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl) prop-2-enoate (PubChem CID 139994874) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl) prop-2-enoate.
| Compound Name | (3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 139994874 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3-tert-butyl-2,2,4,4-tetramethylpentan-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H30O2/c1-11-12(17)18-16(13(2,3)4,14(5,6)7)15(8,9)10/h11H,1H2,2-10H3 |
| InChIKey | GXXMBFJJJNEFDL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|