About tert-butyl prop-2-enoate;2-methylpropan-2-ol
tert-butyl prop-2-enoate;2-methylpropan-2-ol (PubChem CID 157277842) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;2-methylpropan-2-ol |
| PubChem CID | 157277842 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | tert-butyl prop-2-enoate;2-methylpropan-2-ol |
| SMILES | C=CC(=O)OC(C)(C)C.CC(C)(C)O |
| InChI | InChI=1S/C7H12O2.C4H10O/c1-5-6(8)9-7(2,3)4;1-4(2,3)5/h5H,1H2,2-4H3;5H,1-3H3 |
| InChIKey | AZHUVVVUXLPESC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;2-methylpropan-2-ol?
The IUPAC name of tert-butyl prop-2-enoate;2-methylpropan-2-ol (CID 157277842) is tert-butyl prop-2-enoate;2-methylpropan-2-ol.
What is the SMILES notation for tert-butyl prop-2-enoate;2-methylpropan-2-ol?
The canonical SMILES for tert-butyl prop-2-enoate;2-methylpropan-2-ol is C=CC(=O)OC(C)(C)C.CC(C)(C)O.
What is the InChIKey of tert-butyl prop-2-enoate;2-methylpropan-2-ol?
The InChIKey is AZHUVVVUXLPESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C4H10O/c1-5-6(8)9-7(2,3)4;1-4(2,3)5/h5H,1H2,2-4H3;5H,1-3H3.
What are the key properties of tert-butyl prop-2-enoate;2-methylpropan-2-ol?
tert-butyl prop-2-enoate;2-methylpropan-2-ol has a molecular weight of 202.29 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;2-methylpropan-2-ol is sourced from PubChem (CID 157277842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).