About tert-butyl prop-2-enoate;palladium;sulfuric acid
tert-butyl prop-2-enoate;palladium;sulfuric acid (PubChem CID 174893480) has the molecular formula C7H14O6PdS
and a molecular weight of 332.67 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;palladium;sulfuric acid.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;palladium;sulfuric acid |
| PubChem CID | 174893480 |
| Molecular Formula | C7H14O6PdS |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | tert-butyl prop-2-enoate;palladium;sulfuric acid |
| SMILES | C=CC(=O)OC(C)(C)C.O=S(=O)(O)O.[Pd] |
| InChI | InChI=1S/C7H12O2.H2O4S.Pd/c1-5-6(8)9-7(2,3)4;1-5(2,3)4;/h5H,1H2,2-4H3;(H2,1,2,3,4); |
| InChIKey | UNVBFUVXNOFGDN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;palladium;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;palladium;sulfuric acid?
The IUPAC name of tert-butyl prop-2-enoate;palladium;sulfuric acid (CID 174893480) is tert-butyl prop-2-enoate;palladium;sulfuric acid.
What is the SMILES notation for tert-butyl prop-2-enoate;palladium;sulfuric acid?
The canonical SMILES for tert-butyl prop-2-enoate;palladium;sulfuric acid is C=CC(=O)OC(C)(C)C.O=S(=O)(O)O.[Pd].
What is the InChIKey of tert-butyl prop-2-enoate;palladium;sulfuric acid?
The InChIKey is UNVBFUVXNOFGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.H2O4S.Pd/c1-5-6(8)9-7(2,3)4;1-5(2,3)4;/h5H,1H2,2-4H3;(H2,1,2,3,4);.
What are the key properties of tert-butyl prop-2-enoate;palladium;sulfuric acid?
tert-butyl prop-2-enoate;palladium;sulfuric acid has a molecular weight of 332.67 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;palladium;sulfuric acid is sourced from PubChem (CID 174893480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).