About tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane
tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane (PubChem CID 174833427) has the molecular formula C14H30O4
and a molecular weight of 262.39 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane |
| PubChem CID | 174833427 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane |
| SMILES | C.C=CC(=O)OC(C)(C)C.CC(C)OOC(C)C |
| InChI | InChI=1S/C7H12O2.C6H14O2.CH4/c1-5-6(8)9-7(2,3)4;1-5(2)7-8-6(3)4;/h5H,1H2,2-4H3;5-6H,1-4H3;1H4 |
| InChIKey | ZWVMVMMHCLZKDG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane?
The IUPAC name of tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane (CID 174833427) is tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane.
What is the SMILES notation for tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane?
The canonical SMILES for tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane is C.C=CC(=O)OC(C)(C)C.CC(C)OOC(C)C.
What is the InChIKey of tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane?
The InChIKey is ZWVMVMMHCLZKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C6H14O2.CH4/c1-5-6(8)9-7(2,3)4;1-5(2)7-8-6(3)4;/h5H,1H2,2-4H3;5-6H,1-4H3;1H4.
What are the key properties of tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane?
tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane has a molecular weight of 262.39 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;methane;2-propan-2-ylperoxypropane is sourced from PubChem (CID 174833427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).