C10H20O4 — CID 158874239
tert-butyl prop-2-enoate;propane-1,2-diol (PubChem CID 158874239) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;propane-1,2-diol.
| Compound Name | tert-butyl prop-2-enoate;propane-1,2-diol |
|---|---|
| PubChem CID | 158874239 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | tert-butyl prop-2-enoate;propane-1,2-diol |
| SMILES | C=CC(=O)OC(C)(C)C.CC(O)CO |
| InChI | InChI=1S/C7H12O2.C3H8O2/c1-5-6(8)9-7(2,3)4;1-3(5)2-4/h5H,1H2,2-4H3;3-5H,2H2,1H3 |
| InChIKey | JCFSRUKEWVSKGK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|