About tert-butyl prop-2-enoate;propane-1,2-diol
tert-butyl prop-2-enoate;propane-1,2-diol (PubChem CID 158874239) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;propane-1,2-diol.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;propane-1,2-diol |
| PubChem CID | 158874239 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | tert-butyl prop-2-enoate;propane-1,2-diol |
| SMILES | C=CC(=O)OC(C)(C)C.CC(O)CO |
| InChI | InChI=1S/C7H12O2.C3H8O2/c1-5-6(8)9-7(2,3)4;1-3(5)2-4/h5H,1H2,2-4H3;3-5H,2H2,1H3 |
| InChIKey | JCFSRUKEWVSKGK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;propane-1,2-diol?
The IUPAC name of tert-butyl prop-2-enoate;propane-1,2-diol (CID 158874239) is tert-butyl prop-2-enoate;propane-1,2-diol.
What is the SMILES notation for tert-butyl prop-2-enoate;propane-1,2-diol?
The canonical SMILES for tert-butyl prop-2-enoate;propane-1,2-diol is C=CC(=O)OC(C)(C)C.CC(O)CO.
What is the InChIKey of tert-butyl prop-2-enoate;propane-1,2-diol?
The InChIKey is JCFSRUKEWVSKGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C3H8O2/c1-5-6(8)9-7(2,3)4;1-3(5)2-4/h5H,1H2,2-4H3;3-5H,2H2,1H3.
What are the key properties of tert-butyl prop-2-enoate;propane-1,2-diol?
tert-butyl prop-2-enoate;propane-1,2-diol has a molecular weight of 204.27 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;propane-1,2-diol is sourced from PubChem (CID 158874239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).