About potassium;tert-butyl prop-2-enoate;hydride
potassium;tert-butyl prop-2-enoate;hydride (PubChem CID 174867410) has the molecular formula C7H13KO2
and a molecular weight of 168.28 g/mol. Its IUPAC name is potassium;tert-butyl prop-2-enoate;hydride.
Molecular Properties
| Compound Name | potassium;tert-butyl prop-2-enoate;hydride |
| PubChem CID | 174867410 |
| Molecular Formula | C7H13KO2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | potassium;tert-butyl prop-2-enoate;hydride |
| SMILES | C=CC(=O)OC(C)(C)C.[H-].[K+] |
| InChI | InChI=1S/C7H12O2.K.H/c1-5-6(8)9-7(2,3)4;;/h5H,1H2,2-4H3;;/q;+1;-1 |
| InChIKey | SGYCEZIVRIKMFM-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;tert-butyl prop-2-enoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;tert-butyl prop-2-enoate;hydride?
The IUPAC name of potassium;tert-butyl prop-2-enoate;hydride (CID 174867410) is potassium;tert-butyl prop-2-enoate;hydride.
What is the SMILES notation for potassium;tert-butyl prop-2-enoate;hydride?
The canonical SMILES for potassium;tert-butyl prop-2-enoate;hydride is C=CC(=O)OC(C)(C)C.[H-].[K+].
What is the InChIKey of potassium;tert-butyl prop-2-enoate;hydride?
The InChIKey is SGYCEZIVRIKMFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.K.H/c1-5-6(8)9-7(2,3)4;;/h5H,1H2,2-4H3;;/q;+1;-1.
What are the key properties of potassium;tert-butyl prop-2-enoate;hydride?
potassium;tert-butyl prop-2-enoate;hydride has a molecular weight of 168.28 g/mol, XLogP of -1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;tert-butyl prop-2-enoate;hydride is sourced from PubChem (CID 174867410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).