About tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid
tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 86609323) has the molecular formula C15H23O6-
and a molecular weight of 299.34 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| PubChem CID | 86609323 |
| Molecular Formula | C15H23O6- |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)[O-].C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H12O2.2C4H6O2/c1-5-6(8)9-7(2,3)4;2*1-3(2)4(5)6/h5H,1H2,2-4H3;2*1H2,2H3,(H,5,6)/p-1 |
| InChIKey | HILPKBAYZSLSGV-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The IUPAC name of tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid (CID 86609323) is tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid.
What is the SMILES notation for tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The canonical SMILES for tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=C(C)C(=O)[O-].C=CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The InChIKey is HILPKBAYZSLSGV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12O2.2C4H6O2/c1-5-6(8)9-7(2,3)4;2*1-3(2)4(5)6/h5H,1H2,2-4H3;2*1H2,2H3,(H,5,6)/p-1.
What are the key properties of tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid?
tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid has a molecular weight of 299.34 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;2-methylprop-2-enoate;2-methylprop-2-enoic acid is sourced from PubChem (CID 86609323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).