About tert-butyl prop-2-enoate;1,4-dioxane
tert-butyl prop-2-enoate;1,4-dioxane (PubChem CID 174977908) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;1,4-dioxane.
Molecular Properties
| Compound Name | tert-butyl prop-2-enoate;1,4-dioxane |
| PubChem CID | 174977908 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | tert-butyl prop-2-enoate;1,4-dioxane |
| SMILES | C1COCCO1.C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H12O2.C4H8O2/c1-5-6(8)9-7(2,3)4;1-2-6-4-3-5-1/h5H,1H2,2-4H3;1-4H2 |
| InChIKey | UXRFKCIPJIFKFS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl prop-2-enoate;1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl prop-2-enoate;1,4-dioxane?
The IUPAC name of tert-butyl prop-2-enoate;1,4-dioxane (CID 174977908) is tert-butyl prop-2-enoate;1,4-dioxane.
What is the SMILES notation for tert-butyl prop-2-enoate;1,4-dioxane?
The canonical SMILES for tert-butyl prop-2-enoate;1,4-dioxane is C1COCCO1.C=CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl prop-2-enoate;1,4-dioxane?
The InChIKey is UXRFKCIPJIFKFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C4H8O2/c1-5-6(8)9-7(2,3)4;1-2-6-4-3-5-1/h5H,1H2,2-4H3;1-4H2.
What are the key properties of tert-butyl prop-2-enoate;1,4-dioxane?
tert-butyl prop-2-enoate;1,4-dioxane has a molecular weight of 216.28 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl prop-2-enoate;1,4-dioxane is sourced from PubChem (CID 174977908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).