C11H20O4 — CID 174977908
tert-butyl prop-2-enoate;1,4-dioxane (PubChem CID 174977908) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl prop-2-enoate;1,4-dioxane.
| Compound Name | tert-butyl prop-2-enoate;1,4-dioxane |
|---|---|
| PubChem CID | 174977908 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | tert-butyl prop-2-enoate;1,4-dioxane |
| SMILES | C1COCCO1.C=CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H12O2.C4H8O2/c1-5-6(8)9-7(2,3)4;1-2-6-4-3-5-1/h5H,1H2,2-4H3;1-4H2 |
| InChIKey | UXRFKCIPJIFKFS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|