About bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate
bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate (PubChem CID 88763675) has the molecular formula C16H20O8
and a molecular weight of 340.33 g/mol. Its IUPAC name is bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate |
| PubChem CID | 88763675 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate |
| SMILES | C=CC(=O)OC(C)(C)OC(=O)/C=C\C(=O)OC(C)(C)OC(=O)C=C |
| InChI | InChI=1S/C16H20O8/c1-7-11(17)21-15(3,4)23-13(19)9-10-14(20)24-16(5,6)22-12(18)8-2/h7-10H,1-2H2,3-6H3/b10-9- |
| InChIKey | LNBOPGMAPSQXPZ-KTKRTIGZSA-N |
| XLogP | 1.56 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate?
The IUPAC name of bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate (CID 88763675) is bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate.
What is the SMILES notation for bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate?
The canonical SMILES for bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate is C=CC(=O)OC(C)(C)OC(=O)/C=C\C(=O)OC(C)(C)OC(=O)C=C.
What is the InChIKey of bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate?
The InChIKey is LNBOPGMAPSQXPZ-KTKRTIGZSA-N. The full InChI is InChI=1S/C16H20O8/c1-7-11(17)21-15(3,4)23-13(19)9-10-14(20)24-16(5,6)22-12(18)8-2/h7-10H,1-2H2,3-6H3/b10-9-.
What are the key properties of bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate?
bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate has a molecular weight of 340.33 g/mol, XLogP of 1.56, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-prop-2-enoyloxypropan-2-yl) (Z)-but-2-enedioate is sourced from PubChem (CID 88763675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).