C8H2F10O4 — CID 87522002
bis(1,1,2,2,2-pentafluoroethyl) (Z)-but-2-enedioate (PubChem CID 87522002) has the molecular formula C8H2F10O4 and a molecular weight of 352.08 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethyl) (Z)-but-2-enedioate.
| Compound Name | bis(1,1,2,2,2-pentafluoroethyl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 87522002 |
| Molecular Formula | C8H2F10O4 |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethyl) (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)OC(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F10O4/c9-5(10,11)7(15,16)21-3(19)1-2-4(20)22-8(17,18)6(12,13)14/h1-2H/b2-1- |
| InChIKey | DPIUKYICGKTJDT-UPHRSURJSA-N |
| XLogP | 2.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|