2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid

C7H5F5O4 — CID 151447606

IUPAC2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid
SMILESCC=C(C(=O)O)C(=O)OC(F)(F)C(F)(F)F
InChIInChI=1S/C7H5F5O4/c1-2-3(4(13)14)5(15)16-7(11,12)6(8,9)10/h2H,1H3,(H,13,14)
InChIKeyPFUXMZHANSDNGW-UHFFFAOYSA-N
MW248.10 g/mol
LogP1.72
Rot. Bonds3

About 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid

2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid (PubChem CID 151447606) has the molecular formula C7H5F5O4 and a molecular weight of 248.10 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid.

Molecular Properties

Compound Name2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid
PubChem CID151447606
Molecular FormulaC7H5F5O4
Molecular Weight248.10 g/mol
Exact Mass248.01
IUPAC Name2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid
SMILESCC=C(C(=O)O)C(=O)OC(F)(F)C(F)(F)F
InChIInChI=1S/C7H5F5O4/c1-2-3(4(13)14)5(15)16-7(11,12)6(8,9)10/h2H,1H3,(H,13,14)
InChIKeyPFUXMZHANSDNGW-UHFFFAOYSA-N
XLogP1.72
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.10
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid?
The IUPAC name of 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid (CID 151447606) is 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid.
What is the SMILES notation for 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid?
The canonical SMILES for 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid is CC=C(C(=O)O)C(=O)OC(F)(F)C(F)(F)F.
What is the InChIKey of 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid?
The InChIKey is PFUXMZHANSDNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F5O4/c1-2-3(4(13)14)5(15)16-7(11,12)6(8,9)10/h2H,1H3,(H,13,14).
What are the key properties of 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid?
2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid has a molecular weight of 248.10 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid is sourced from PubChem (CID 151447606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).