C7H5F5O4 — CID 151447606
2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid (PubChem CID 151447606) has the molecular formula C7H5F5O4 and a molecular weight of 248.10 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid |
|---|---|
| PubChem CID | 151447606 |
| Molecular Formula | C7H5F5O4 |
| Molecular Weight | 248.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethoxycarbonyl)but-2-enoic acid |
| SMILES | CC=C(C(=O)O)C(=O)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F5O4/c1-2-3(4(13)14)5(15)16-7(11,12)6(8,9)10/h2H,1H3,(H,13,14) |
| InChIKey | PFUXMZHANSDNGW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.10 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|