C13H6ClF17O2 — CID 175049393
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl 2-chloropent-2-enoate (PubChem CID 175049393) has the molecular formula C13H6ClF17O2 and a molecular weight of 552.61 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl 2-chloropent-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl 2-chloropent-2-enoate |
|---|---|
| PubChem CID | 175049393 |
| Molecular Formula | C13H6ClF17O2 |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 551.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl 2-chloropent-2-enoate |
| SMILES | CCC=C(Cl)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H6ClF17O2/c1-2-3-4(14)5(32)33-13(30,31)11(25,26)9(21,22)7(17,18)6(15,16)8(19,20)10(23,24)12(27,28)29/h3H,2H2,1H3 |
| InChIKey | RMOSPFGDKIIYRR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|