C13H7F17NO4S- — CID 174554203
2-amino-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-1-oxopent-2-ene-3-sulfinate (PubChem CID 174554203) has the molecular formula C13H7F17NO4S- and a molecular weight of 596.23 g/mol. Its IUPAC name is 2-amino-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-1-oxopent-2-ene-3-sulfinate.
| Compound Name | 2-amino-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-1-oxopent-2-ene-3-sulfinate |
|---|---|
| PubChem CID | 174554203 |
| Molecular Formula | C13H7F17NO4S- |
| Molecular Weight | 596.23 g/mol |
| Exact Mass | 595.98 |
| IUPAC Name | 2-amino-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)-1-oxopent-2-ene-3-sulfinate |
| SMILES | CCC(=C(N)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)[O-] |
| InChI | InChI=1S/C13H8F17NO4S/c1-2-3(36(33)34)4(31)5(32)35-13(29,30)11(24,25)9(20,21)7(16,17)6(14,15)8(18,19)10(22,23)12(26,27)28/h2,31H2,1H3,(H,33,34)/p-1 |
| InChIKey | LSPNMTYVHKUBDW-UHFFFAOYSA-M |
| XLogP | 4.96 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|