C15H14F13NO2S — CID 172834019
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 3-(2-aminoethyl)-2-methyl-4-sulfanylidenehex-2-enoate (PubChem CID 172834019) has the molecular formula C15H14F13NO2S and a molecular weight of 519.32 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 3-(2-aminoethyl)-2-methyl-4-sulfanylidenehex-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 3-(2-aminoethyl)-2-methyl-4-sulfanylidenehex-2-enoate |
|---|---|
| PubChem CID | 172834019 |
| Molecular Formula | C15H14F13NO2S |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl 3-(2-aminoethyl)-2-methyl-4-sulfanylidenehex-2-enoate |
| SMILES | CCC(=S)C(CCN)=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F13NO2S/c1-3-8(32)7(4-5-29)6(2)9(30)31-15(27,28)13(22,23)11(18,19)10(16,17)12(20,21)14(24,25)26/h3-5,29H2,1-2H3 |
| InChIKey | VXEVPEDAAZNORP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|