C15H9F19O2 — CID 23505130
[1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluoro-7-(trifluoromethyl)octyl] 2-methylidenepentanoate (PubChem CID 23505130) has the molecular formula C15H9F19O2 and a molecular weight of 582.20 g/mol. Its IUPAC name is [1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluoro-7-(trifluoromethyl)octyl] 2-methylidenepentanoate.
| Compound Name | [1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluoro-7-(trifluoromethyl)octyl] 2-methylidenepentanoate |
|---|---|
| PubChem CID | 23505130 |
| Molecular Formula | C15H9F19O2 |
| Molecular Weight | 582.20 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | [1,1,2,2,3,3,4,4,5,5,6,6,7,8,8,8-hexadecafluoro-7-(trifluoromethyl)octyl] 2-methylidenepentanoate |
| SMILES | C=C(CCC)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H9F19O2/c1-3-4-5(2)6(35)36-15(33,34)12(25,26)11(23,24)10(21,22)9(19,20)8(17,18)7(16,13(27,28)29)14(30,31)32/h2-4H2,1H3 |
| InChIKey | BJCOHIDQCWOODE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.20 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|