C12H7F19O — CID 135287934
1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-propoxy-2-(trifluoromethyl)octane (PubChem CID 135287934) has the molecular formula C12H7F19O and a molecular weight of 528.15 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-propoxy-2-(trifluoromethyl)octane.
| Compound Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-propoxy-2-(trifluoromethyl)octane |
|---|---|
| PubChem CID | 135287934 |
| Molecular Formula | C12H7F19O |
| Molecular Weight | 528.15 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-propoxy-2-(trifluoromethyl)octane |
| SMILES | CCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7F19O/c1-2-3-32-12(30,31)9(22,23)8(20,21)7(18,19)6(16,17)5(14,15)4(13,10(24,25)26)11(27,28)29/h2-3H2,1H3 |
| InChIKey | LYHFVVIFNRJKEB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.15 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|