C9H7F13O — CID 15006619
1,1,1,2,2,3,3,5,5,5-decafluoro-4-propoxy-4-(trifluoromethyl)pentane (PubChem CID 15006619) has the molecular formula C9H7F13O and a molecular weight of 378.13 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,5,5-decafluoro-4-propoxy-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-propoxy-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 15006619 |
| Molecular Formula | C9H7F13O |
| Molecular Weight | 378.13 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-propoxy-4-(trifluoromethyl)pentane |
| SMILES | CCCOC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F13O/c1-2-3-23-4(7(14,15)16,8(17,18)19)5(10,11)6(12,13)9(20,21)22/h2-3H2,1H3 |
| InChIKey | TYJBEKCQAONCAM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.13 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|