C14H14F18O2Sn — CID 87371103
bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-dipropoxystannane (PubChem CID 87371103) has the molecular formula C14H14F18O2Sn and a molecular weight of 674.94 g/mol. Its IUPAC name is bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-dipropoxystannane.
| Compound Name | bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-dipropoxystannane |
|---|---|
| PubChem CID | 87371103 |
| Molecular Formula | C14H14F18O2Sn |
| Molecular Weight | 674.94 g/mol |
| Exact Mass | 675.97 |
| IUPAC Name | bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-dipropoxystannane |
| SMILES | CCCO[Sn](OCCC)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C4F9.2C3H7O.Sn/c2*5-1(6)2(7,8)3(9,10)4(11,12)13;2*1-2-3-4;/h;;2*2-3H2,1H3;/q;;2*-1;+2 |
| InChIKey | VLWLOKDWBJTJDX-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.94 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|