C14H22F10O2Sn — CID 87372064
bis(1,1,2,2,3-pentafluorobutyl)-dipropoxystannane (PubChem CID 87372064) has the molecular formula C14H22F10O2Sn and a molecular weight of 531.02 g/mol. Its IUPAC name is bis(1,1,2,2,3-pentafluorobutyl)-dipropoxystannane.
| Compound Name | bis(1,1,2,2,3-pentafluorobutyl)-dipropoxystannane |
|---|---|
| PubChem CID | 87372064 |
| Molecular Formula | C14H22F10O2Sn |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | bis(1,1,2,2,3-pentafluorobutyl)-dipropoxystannane |
| SMILES | CCCO[Sn](OCCC)(C(F)(F)C(F)(F)C(C)F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/2C4H4F5.2C3H7O.Sn/c2*1-2(5)4(8,9)3(6)7;2*1-2-3-4;/h2*2H,1H3;2*2-3H2,1H3;/q;;2*-1;+2 |
| InChIKey | BATLLZOZMWDZOQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|