C32H50F20O3Sn2 — CID 23115024
octoxy-[octoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane (PubChem CID 23115024) has the molecular formula C32H50F20O3Sn2 and a molecular weight of 1100.13 g/mol. Its IUPAC name is octoxy-[octoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane.
| Compound Name | octoxy-[octoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane |
|---|---|
| PubChem CID | 23115024 |
| Molecular Formula | C32H50F20O3Sn2 |
| Molecular Weight | 1100.13 g/mol |
| Exact Mass | 1102.15 |
| IUPAC Name | octoxy-[octoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane |
| SMILES | CCCCCCCCO[Sn](O[Sn](OCCCCCCCC)(C(F)(F)C(F)(F)C(C)F)C(F)(F)C(F)(F)C(C)F)(C(F)(F)C(F)(F)C(C)F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/2C8H17O.4C4H4F5.O.2Sn/c2*1-2-3-4-5-6-7-8-9;4*1-2(5)4(8,9)3(6)7;;;/h2*2-8H2,1H3;4*2H,1H3;;;/q2*-1;;;;;;2*+1 |
| InChIKey | VLRVWHGKVUWLRC-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1100.13 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|