C22H22F28O3Sn2 — CID 23073839
[bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannane (PubChem CID 23073839) has the molecular formula C22H22F28O3Sn2 and a molecular weight of 1103.78 g/mol. Its IUPAC name is [bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannane.
| Compound Name | [bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannane |
|---|---|
| PubChem CID | 23073839 |
| Molecular Formula | C22H22F28O3Sn2 |
| Molecular Weight | 1103.78 g/mol |
| Exact Mass | 1105.92 |
| IUPAC Name | [bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannyl]oxy-bis(1,1,2,2,3,3,4-heptafluorobutyl)-propoxystannane |
| SMILES | CCCO[Sn](O[Sn](OCCC)(C(F)(F)C(F)(F)C(F)(F)CF)C(F)(F)C(F)(F)C(F)(F)CF)(C(F)(F)C(F)(F)C(F)(F)CF)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/4C4H2F7.2C3H7O.O.2Sn/c4*5-1-3(8,9)4(10,11)2(6)7;2*1-2-3-4;;;/h4*1H2;2*2-3H2,1H3;;;/q;;;;2*-1;;2*+1 |
| InChIKey | GCZNZQWPLMXOAJ-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1103.78 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|