C24H34F20O3Sn2 — CID 23073814
butoxy-[butoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane (PubChem CID 23073814) has the molecular formula C24H34F20O3Sn2 and a molecular weight of 987.91 g/mol. Its IUPAC name is butoxy-[butoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane.
| Compound Name | butoxy-[butoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane |
|---|---|
| PubChem CID | 23073814 |
| Molecular Formula | C24H34F20O3Sn2 |
| Molecular Weight | 987.91 g/mol |
| Exact Mass | 990.02 |
| IUPAC Name | butoxy-[butoxy-bis(1,1,2,2,3-pentafluorobutyl)stannyl]oxy-bis(1,1,2,2,3-pentafluorobutyl)stannane |
| SMILES | CCCCO[Sn](O[Sn](OCCCC)(C(F)(F)C(F)(F)C(C)F)C(F)(F)C(F)(F)C(C)F)(C(F)(F)C(F)(F)C(C)F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/4C4H4F5.2C4H9O.O.2Sn/c4*1-2(5)4(8,9)3(6)7;2*1-2-3-4-5;;;/h4*2H,1H3;2*2-4H2,1H3;;;/q;;;;2*-1;;2*+1 |
| InChIKey | VOYJONKKZZEIBK-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.91 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|