C14H20F12O2Sn — CID 151771699
bis(1,1,2,4,4,4-hexafluorobutyl)-dipropoxystannane (PubChem CID 151771699) has the molecular formula C14H20F12O2Sn and a molecular weight of 567.00 g/mol. Its IUPAC name is bis(1,1,2,4,4,4-hexafluorobutyl)-dipropoxystannane.
| Compound Name | bis(1,1,2,4,4,4-hexafluorobutyl)-dipropoxystannane |
|---|---|
| PubChem CID | 151771699 |
| Molecular Formula | C14H20F12O2Sn |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | bis(1,1,2,4,4,4-hexafluorobutyl)-dipropoxystannane |
| SMILES | CCCO[Sn](OCCC)(C(F)(F)C(F)CC(F)(F)F)C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/2C4H3F6.2C3H7O.Sn/c2*5-2(3(6)7)1-4(8,9)10;2*1-2-3-4;/h2*2H,1H2;2*2-3H2,1H3;/q;;2*-1;+2 |
| InChIKey | RSSIQBBWNZYYRI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |