C14H26F6O2Sn — CID 87371066
dipropoxy-bis(4,4,4-trifluorobutyl)stannane (PubChem CID 87371066) has the molecular formula C14H26F6O2Sn and a molecular weight of 459.06 g/mol. Its IUPAC name is dipropoxy-bis(4,4,4-trifluorobutyl)stannane.
| Compound Name | dipropoxy-bis(4,4,4-trifluorobutyl)stannane |
|---|---|
| PubChem CID | 87371066 |
| Molecular Formula | C14H26F6O2Sn |
| Molecular Weight | 459.06 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | dipropoxy-bis(4,4,4-trifluorobutyl)stannane |
| SMILES | CCCO[Sn](CCCC(F)(F)F)(CCCC(F)(F)F)OCCC |
| InChI | InChI=1S/2C4H6F3.2C3H7O.Sn/c2*1-2-3-4(5,6)7;2*1-2-3-4;/h2*1-3H2;2*2-3H2,1H3;/q;;2*-1;+2 |
| InChIKey | KOYXGVQXLAMGQI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.06 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |