C11H25F3O3Si — CID 175508235
1,1,1-trifluorooctane;trimethoxysilane (PubChem CID 175508235) has the molecular formula C11H25F3O3Si and a molecular weight of 290.40 g/mol. Its IUPAC name is 1,1,1-trifluorooctane;trimethoxysilane.
| Compound Name | 1,1,1-trifluorooctane;trimethoxysilane |
|---|---|
| PubChem CID | 175508235 |
| Molecular Formula | C11H25F3O3Si |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1,1,1-trifluorooctane;trimethoxysilane |
| SMILES | CCCCCCCC(F)(F)F.CO[SiH](OC)OC |
| InChI | InChI=1S/C8H15F3.C3H10O3Si/c1-2-3-4-5-6-7-8(9,10)11;1-4-7(5-2)6-3/h2-7H2,1H3;7H,1-3H3 |
| InChIKey | YFOCAQNBIFKEEV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|