C17H33F3O3 — CID 150730779
1,1,1-trifluoro-5-(trimethoxymethyl)tridecane (PubChem CID 150730779) has the molecular formula C17H33F3O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-(trimethoxymethyl)tridecane.
| Compound Name | 1,1,1-trifluoro-5-(trimethoxymethyl)tridecane |
|---|---|
| PubChem CID | 150730779 |
| Molecular Formula | C17H33F3O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1,1,1-trifluoro-5-(trimethoxymethyl)tridecane |
| SMILES | CCCCCCCCC(CCCC(F)(F)F)C(OC)(OC)OC |
| InChI | InChI=1S/C17H33F3O3/c1-5-6-7-8-9-10-12-15(13-11-14-16(18,19)20)17(21-2,22-3)23-4/h15H,5-14H2,1-4H3 |
| InChIKey | JRULDCXWWPSFDK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|