About butan-1-amine;4-(trimethoxymethyl)dodecane
butan-1-amine;4-(trimethoxymethyl)dodecane (PubChem CID 159368257) has the molecular formula C20H45NO3
and a molecular weight of 347.58 g/mol. Its IUPAC name is butan-1-amine;4-(trimethoxymethyl)dodecane.
Molecular Properties
| Compound Name | butan-1-amine;4-(trimethoxymethyl)dodecane |
| PubChem CID | 159368257 |
| Molecular Formula | C20H45NO3 |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.34 |
| IUPAC Name | butan-1-amine;4-(trimethoxymethyl)dodecane |
| SMILES | CCCCCCCCC(CCC)C(OC)(OC)OC.CCCCN |
| InChI | InChI=1S/C16H34O3.C4H11N/c1-6-8-9-10-11-12-14-15(13-7-2)16(17-3,18-4)19-5;1-2-3-4-5/h15H,6-14H2,1-5H3;2-5H2,1H3 |
| InChIKey | LJKFHXLSWQGRBB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;4-(trimethoxymethyl)dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;4-(trimethoxymethyl)dodecane?
The IUPAC name of butan-1-amine;4-(trimethoxymethyl)dodecane (CID 159368257) is butan-1-amine;4-(trimethoxymethyl)dodecane.
What is the SMILES notation for butan-1-amine;4-(trimethoxymethyl)dodecane?
The canonical SMILES for butan-1-amine;4-(trimethoxymethyl)dodecane is CCCCCCCCC(CCC)C(OC)(OC)OC.CCCCN.
What is the InChIKey of butan-1-amine;4-(trimethoxymethyl)dodecane?
The InChIKey is LJKFHXLSWQGRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3.C4H11N/c1-6-8-9-10-11-12-14-15(13-7-2)16(17-3,18-4)19-5;1-2-3-4-5/h15H,6-14H2,1-5H3;2-5H2,1H3.
What are the key properties of butan-1-amine;4-(trimethoxymethyl)dodecane?
butan-1-amine;4-(trimethoxymethyl)dodecane has a molecular weight of 347.58 g/mol, XLogP of 5.49, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;4-(trimethoxymethyl)dodecane is sourced from PubChem (CID 159368257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).