C17H38N2O3 — CID 150981687
N'-[4-(trimethoxymethyl)undecyl]ethane-1,2-diamine (PubChem CID 150981687) has the molecular formula C17H38N2O3 and a molecular weight of 318.50 g/mol. Its IUPAC name is N'-[4-(trimethoxymethyl)undecyl]ethane-1,2-diamine.
| Compound Name | N'-[4-(trimethoxymethyl)undecyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 150981687 |
| Molecular Formula | C17H38N2O3 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | N'-[4-(trimethoxymethyl)undecyl]ethane-1,2-diamine |
| SMILES | CCCCCCCC(CCCNCCN)C(OC)(OC)OC |
| InChI | InChI=1S/C17H38N2O3/c1-5-6-7-8-9-11-16(12-10-14-19-15-13-18)17(20-2,21-3)22-4/h16,19H,5-15,18H2,1-4H3 |
| InChIKey | LQFSFNSKVAFOJK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|