C18H40N2O2 — CID 150867086
N'-[4-(1,1-dimethoxyethyl)dodecyl]ethane-1,2-diamine (PubChem CID 150867086) has the molecular formula C18H40N2O2 and a molecular weight of 316.53 g/mol. Its IUPAC name is N'-[4-(1,1-dimethoxyethyl)dodecyl]ethane-1,2-diamine.
| Compound Name | N'-[4-(1,1-dimethoxyethyl)dodecyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 150867086 |
| Molecular Formula | C18H40N2O2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | N'-[4-(1,1-dimethoxyethyl)dodecyl]ethane-1,2-diamine |
| SMILES | CCCCCCCCC(CCCNCCN)C(C)(OC)OC |
| InChI | InChI=1S/C18H40N2O2/c1-5-6-7-8-9-10-12-17(18(2,21-3)22-4)13-11-15-20-16-14-19/h17,20H,5-16,19H2,1-4H3 |
| InChIKey | KTGXWDZUZLWXOF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|