C20H43NO4 — CID 151926052
2-[4-(1,1-dimethoxyethyl)dodecyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 151926052) has the molecular formula C20H43NO4 and a molecular weight of 361.57 g/mol. Its IUPAC name is 2-[4-(1,1-dimethoxyethyl)dodecyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[4-(1,1-dimethoxyethyl)dodecyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 151926052 |
| Molecular Formula | C20H43NO4 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.32 |
| IUPAC Name | 2-[4-(1,1-dimethoxyethyl)dodecyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCCCCCCC(CCCN(CCO)CCO)C(C)(OC)OC |
| InChI | InChI=1S/C20H43NO4/c1-5-6-7-8-9-10-12-19(20(2,24-3)25-4)13-11-14-21(15-17-22)16-18-23/h19,22-23H,5-18H2,1-4H3 |
| InChIKey | SXTVZWQIXVJKSC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|